C10H8BrN5 — CID 107085672
3-(bromomethyl)-2-(1,2,4-triazol-1-yl)imidazo[1,2-a]pyridine (PubChem CID 107085672) has the molecular formula C10H8BrN5 and a molecular weight of 278.11 g/mol. Its IUPAC name is 3-(bromomethyl)-2-(1,2,4-triazol-1-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(bromomethyl)-2-(1,2,4-triazol-1-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 107085672 |
| Molecular Formula | C10H8BrN5 |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 3-(bromomethyl)-2-(1,2,4-triazol-1-yl)imidazo[1,2-a]pyridine |
| SMILES | BrCc1c(-n2cncn2)nc2ccccn12 |
| InChI | InChI=1S/C10H8BrN5/c11-5-8-10(16-7-12-6-13-16)14-9-3-1-2-4-15(8)9/h1-4,6-7H,5H2 |
| InChIKey | HTVLGRZIYJQBJF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|