C15H20O6 — CID 10709038
(3aS,3'aS,7S,7'S,7aS,7'aS)-7,7'-dimethyl-5,5'-spirobi[3a,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran]-2,2'-dione (PubChem CID 10709038) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (3aS,3'aS,7S,7'S,7aS,7'aS)-7,7'-dimethyl-5,5'-spirobi[3a,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran]-2,2'-dione.
| Compound Name | (3aS,3'aS,7S,7'S,7aS,7'aS)-7,7'-dimethyl-5,5'-spirobi[3a,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran]-2,2'-dione |
|---|---|
| PubChem CID | 10709038 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (3aS,3'aS,7S,7'S,7aS,7'aS)-7,7'-dimethyl-5,5'-spirobi[3a,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran]-2,2'-dione |
| SMILES | C[C@H]1CC2(C[C@H](C)[C@@H]3OC(=O)C[C@@H]3O2)O[C@H]2CC(=O)O[C@H]21 |
| InChI | InChI=1S/C15H20O6/c1-7-5-15(20-9-3-11(16)18-13(7)9)6-8(2)14-10(21-15)4-12(17)19-14/h7-10,13-14H,3-6H2,1-2H3/t7-,8-,9-,10-,13-,14-,15?/m0/s1 |
| InChIKey | XHRDRCITLWVCEX-RQFWQEHJSA-N |
| XLogP | 1.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |