C14H18O6 — CID 139090213
(1S,2R,4R,5R)-2-methyl-4-[(1S,2R,4R,5R)-2-methyl-7-oxo-3,6-dioxabicyclo[3.2.1]octan-4-yl]-3,6-dioxabicyclo[3.2.1]octan-7-one (PubChem CID 139090213) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is (1S,2R,4R,5R)-2-methyl-4-[(1S,2R,4R,5R)-2-methyl-7-oxo-3,6-dioxabicyclo[3.2.1]octan-4-yl]-3,6-dioxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1S,2R,4R,5R)-2-methyl-4-[(1S,2R,4R,5R)-2-methyl-7-oxo-3,6-dioxabicyclo[3.2.1]octan-4-yl]-3,6-dioxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 139090213 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (1S,2R,4R,5R)-2-methyl-4-[(1S,2R,4R,5R)-2-methyl-7-oxo-3,6-dioxabicyclo[3.2.1]octan-4-yl]-3,6-dioxabicyclo[3.2.1]octan-7-one |
| SMILES | C[C@H]1O[C@@H]([C@@H]2O[C@H](C)[C@@H]3C[C@H]2OC3=O)[C@H]2C[C@@H]1C(=O)O2 |
| InChI | InChI=1S/C14H18O6/c1-5-7-3-9(19-13(7)15)11(17-5)12-10-4-8(6(2)18-12)14(16)20-10/h5-12H,3-4H2,1-2H3/t5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | QVRUVXLWHFNCHY-VGEDYCIUSA-N |
| XLogP | 0.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |