C14H9BrF2N2O — CID 107098249
4-(5-bromo-2,3-difluorophenoxy)-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 107098249) has the molecular formula C14H9BrF2N2O and a molecular weight of 339.14 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluorophenoxy)-2,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 4-(5-bromo-2,3-difluorophenoxy)-2,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 107098249 |
| Molecular Formula | C14H9BrF2N2O |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 4-(5-bromo-2,3-difluorophenoxy)-2,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(Oc2cc(Br)cc(F)c2F)c(C#N)c(C)n1 |
| InChI | InChI=1S/C14H9BrF2N2O/c1-7-3-12(10(6-18)8(2)19-7)20-13-5-9(15)4-11(16)14(13)17/h3-5H,1-2H3 |
| InChIKey | ZCBHZPDQSKRVMO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|