C18H16O3S — CID 10710249
(4R,5S)-5-phenacyl-4-phenylsulfanyloxolan-2-one (PubChem CID 10710249) has the molecular formula C18H16O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is (4R,5S)-5-phenacyl-4-phenylsulfanyloxolan-2-one.
| Compound Name | (4R,5S)-5-phenacyl-4-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10710249 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (4R,5S)-5-phenacyl-4-phenylsulfanyloxolan-2-one |
| SMILES | O=C1C[C@@H](Sc2ccccc2)[C@H](CC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C18H16O3S/c19-15(13-7-3-1-4-8-13)11-16-17(12-18(20)21-16)22-14-9-5-2-6-10-14/h1-10,16-17H,11-12H2/t16-,17+/m0/s1 |
| InChIKey | OHUTZWFHXSQASI-DLBZAZTESA-N |
| XLogP | 3.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |