C16H23NO4S — CID 10711185
[(3S)-1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methyl methanesulfonate (PubChem CID 10711185) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is [(3S)-1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methyl methanesulfonate.
| Compound Name | [(3S)-1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10711185 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(3S)-1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)c1ccc(N2C[C@@H](COS(C)(=O)=O)CC2=O)cc1 |
| InChI | InChI=1S/C16H23NO4S/c1-16(2,3)13-5-7-14(8-6-13)17-10-12(9-15(17)18)11-21-22(4,19)20/h5-8,12H,9-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | KMIOBOSRMHSALY-LBPRGKRZSA-N |
| XLogP | 2.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|