C29H32N2O7 — CID 1071122
propan-2-yl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methyl-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1071122) has the molecular formula C29H32N2O7 and a molecular weight of 520.58 g/mol. Its IUPAC name is propan-2-yl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methyl-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | propan-2-yl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methyl-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1071122 |
| Molecular Formula | C29H32N2O7 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | propan-2-yl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methyl-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC(C)C)[C@@H]3c2ccc(C)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C29H32N2O7/c1-15(2)38-29(33)26-17(4)30-21-11-20(18-9-10-24(36-5)25(14-18)37-6)13-23(32)28(21)27(26)19-8-7-16(3)22(12-19)31(34)35/h7-10,12,14-15,20,27,30H,11,13H2,1-6H3/t20-,27-/m0/s1 |
| InChIKey | RVLUZNMSTJZRDR-DCFHFQCYSA-N |
| XLogP | 5.23 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|