C15H15N3O4S — CID 10711694
methyl (2Z)-2-methoxyimino-2-[2-[(E)-(3-methoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]acetate (PubChem CID 10711694) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is methyl (2Z)-2-methoxyimino-2-[2-[(E)-(3-methoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl (2Z)-2-methoxyimino-2-[2-[(E)-(3-methoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 10711694 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl (2Z)-2-methoxyimino-2-[2-[(E)-(3-methoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CO/N=C(\C(=O)OC)c1csc(/N=C/c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C15H15N3O4S/c1-20-11-6-4-5-10(7-11)8-16-15-17-12(9-23-15)13(18-22-3)14(19)21-2/h4-9H,1-3H3/b16-8+,18-13- |
| InChIKey | DSTWDASTWVNUHD-XCRGMJEXSA-N |
| XLogP | 2.43 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|