C12H16O6Se — CID 10711820
ethyl 2-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]selenophene-3-carboxylate (PubChem CID 10711820) has the molecular formula C12H16O6Se and a molecular weight of 335.21 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]selenophene-3-carboxylate.
| Compound Name | ethyl 2-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]selenophene-3-carboxylate |
|---|---|
| PubChem CID | 10711820 |
| Molecular Formula | C12H16O6Se |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | ethyl 2-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]selenophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc[se]c1[C@H]1O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16O6Se/c1-2-17-12(16)6-3-4-19-11(6)10-9(15)8(14)7(5-13)18-10/h3-4,7-10,13-15H,2,5H2,1H3/t7-,8+,9+,10+/m1/s1 |
| InChIKey | YDGXYXJYZFJBSW-KATARQTJSA-N |
| XLogP | -0.93 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|