C13H14F2N2O3 — CID 107122311
N-(1-ethylcyclobutyl)-2,5-difluoro-3-nitrobenzamide (PubChem CID 107122311) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is N-(1-ethylcyclobutyl)-2,5-difluoro-3-nitrobenzamide.
| Compound Name | N-(1-ethylcyclobutyl)-2,5-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 107122311 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-(1-ethylcyclobutyl)-2,5-difluoro-3-nitrobenzamide |
| SMILES | CCC1(NC(=O)c2cc(F)cc([N+](=O)[O-])c2F)CCC1 |
| InChI | InChI=1S/C13H14F2N2O3/c1-2-13(4-3-5-13)16-12(18)9-6-8(14)7-10(11(9)15)17(19)20/h6-7H,2-5H2,1H3,(H,16,18) |
| InChIKey | CPSWMHDEKKSEOT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|