C13H11F2NO3 — CID 107123757
(3-amino-2,5-difluorophenyl)-[5-(methoxymethyl)furan-2-yl]methanone (PubChem CID 107123757) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-[5-(methoxymethyl)furan-2-yl]methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-[5-(methoxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 107123757 |
| Molecular Formula | C13H11F2NO3 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-[5-(methoxymethyl)furan-2-yl]methanone |
| SMILES | COCc1ccc(C(=O)c2cc(F)cc(N)c2F)o1 |
| InChI | InChI=1S/C13H11F2NO3/c1-18-6-8-2-3-11(19-8)13(17)9-4-7(14)5-10(16)12(9)15/h2-5H,6,16H2,1H3 |
| InChIKey | XVJIFKYZWZSJTD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|