C7H9NO2S — CID 127005352
5-(methoxymethyl)furan-2-carbothioamide (PubChem CID 127005352) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is 5-(methoxymethyl)furan-2-carbothioamide.
| Compound Name | 5-(methoxymethyl)furan-2-carbothioamide |
|---|---|
| PubChem CID | 127005352 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 5-(methoxymethyl)furan-2-carbothioamide |
| SMILES | COCc1ccc(C(N)=S)o1 |
| InChI | InChI=1S/C7H9NO2S/c1-9-4-5-2-3-6(10-5)7(8)11/h2-3H,4H2,1H3,(H2,8,11) |
| InChIKey | NCUCBWALVVAUGL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|