C17H34O5Si — CID 10712629
ethyl (3S,4S)-3-hydroperoxy-2-methylidene-4-tri(propan-2-yl)silyloxypentanoate (PubChem CID 10712629) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is ethyl (3S,4S)-3-hydroperoxy-2-methylidene-4-tri(propan-2-yl)silyloxypentanoate.
| Compound Name | ethyl (3S,4S)-3-hydroperoxy-2-methylidene-4-tri(propan-2-yl)silyloxypentanoate |
|---|---|
| PubChem CID | 10712629 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | ethyl (3S,4S)-3-hydroperoxy-2-methylidene-4-tri(propan-2-yl)silyloxypentanoate |
| SMILES | C=C(C(=O)OCC)[C@H](OO)[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-10-20-17(18)14(8)16(21-19)15(9)22-23(11(2)3,12(4)5)13(6)7/h11-13,15-16,19H,8,10H2,1-7,9H3/t15-,16-/m0/s1 |
| InChIKey | JCXLEJVQUZWZKW-HOTGVXAUSA-N |
| XLogP | 4.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|