C17H23NO2S — CID 107133706
4-phenyl-1-(thiolan-3-ylmethyl)piperidine-4-carboxylic acid (PubChem CID 107133706) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 4-phenyl-1-(thiolan-3-ylmethyl)piperidine-4-carboxylic acid.
| Compound Name | 4-phenyl-1-(thiolan-3-ylmethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107133706 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-phenyl-1-(thiolan-3-ylmethyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2)CCN(CC2CCSC2)CC1 |
| InChI | InChI=1S/C17H23NO2S/c19-16(20)17(15-4-2-1-3-5-15)7-9-18(10-8-17)12-14-6-11-21-13-14/h1-5,14H,6-13H2,(H,19,20) |
| InChIKey | VICNWILQCGSKKA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |