C15H21NO9 — CID 10713464
diethyl 2-nitro-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]pentanedioate (PubChem CID 10713464) has the molecular formula C15H21NO9 and a molecular weight of 359.33 g/mol. Its IUPAC name is diethyl 2-nitro-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]pentanedioate.
| Compound Name | diethyl 2-nitro-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]pentanedioate |
|---|---|
| PubChem CID | 10713464 |
| Molecular Formula | C15H21NO9 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | diethyl 2-nitro-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]pentanedioate |
| SMILES | CCOC(=O)CCC(C(=O)OCC)([C@H]1CC(=O)[C@@H]2OC[C@H]1O2)[N+](=O)[O-] |
| InChI | InChI=1S/C15H21NO9/c1-3-22-12(18)5-6-15(16(20)21,14(19)23-4-2)9-7-10(17)13-24-8-11(9)25-13/h9,11,13H,3-8H2,1-2H3/t9-,11+,13+,15?/m0/s1 |
| InChIKey | ZCXKILCZFILKOA-ZGLXMYHVSA-N |
| XLogP | 0.24 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|