C18H20O11 — CID 11729313
ethyl (2R)-2-[(4S)-4-methyl-2,5,6-trioxo-3,8,10-trioxabicyclo[5.2.1]decan-4-yl]-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]acetate (PubChem CID 11729313) has the molecular formula C18H20O11 and a molecular weight of 412.35 g/mol. Its IUPAC name is ethyl (2R)-2-[(4S)-4-methyl-2,5,6-trioxo-3,8,10-trioxabicyclo[5.2.1]decan-4-yl]-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]acetate.
| Compound Name | ethyl (2R)-2-[(4S)-4-methyl-2,5,6-trioxo-3,8,10-trioxabicyclo[5.2.1]decan-4-yl]-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]acetate |
|---|---|
| PubChem CID | 11729313 |
| Molecular Formula | C18H20O11 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | ethyl (2R)-2-[(4S)-4-methyl-2,5,6-trioxo-3,8,10-trioxabicyclo[5.2.1]decan-4-yl]-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]acetate |
| SMILES | CCOC(=O)[C@H]([C@H]1CC(=O)[C@@H]2OC[C@H]1O2)[C@]1(C)OC(=O)C2COC(O2)C(=O)C1=O |
| InChI | InChI=1S/C18H20O11/c1-3-24-15(23)11(7-4-8(19)16-25-5-9(7)27-16)18(2)13(21)12(20)17-26-6-10(28-17)14(22)29-18/h7,9-11,16-17H,3-6H2,1-2H3/t7-,9+,10?,11-,16+,17?,18-/m0/s1 |
| InChIKey | GIRNHPFIPKPVSQ-NRUITNBPSA-N |
| XLogP | -1.31 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|