C11H15NO7 — CID 10635960
ethyl 2-nitro-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]propanoate (PubChem CID 10635960) has the molecular formula C11H15NO7 and a molecular weight of 273.24 g/mol. Its IUPAC name is ethyl 2-nitro-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]propanoate.
| Compound Name | ethyl 2-nitro-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]propanoate |
|---|---|
| PubChem CID | 10635960 |
| Molecular Formula | C11H15NO7 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | ethyl 2-nitro-2-[(1S,2R,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]propanoate |
| SMILES | CCOC(=O)C(C)([C@H]1CC(=O)[C@@H]2OC[C@H]1O2)[N+](=O)[O-] |
| InChI | InChI=1S/C11H15NO7/c1-3-17-10(14)11(2,12(15)16)6-4-7(13)9-18-5-8(6)19-9/h6,8-9H,3-5H2,1-2H3/t6-,8+,9+,11?/m0/s1 |
| InChIKey | JSUDTIUOKCFIJA-HRPZJAGZSA-N |
| XLogP | -0.08 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|