C16H21NO6 — CID 177109460
[2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate (PubChem CID 177109460) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate.
| Compound Name | [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 177109460 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1COC(c2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C16H21NO6/c1-4-16(2,3)15(18)22-10-11-9-21-14(23-11)12-7-5-6-8-13(12)17(19)20/h5-8,11,14H,4,9-10H2,1-3H3 |
| InChIKey | CZSLLOIHCWLBAQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|