About [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate
[2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate (PubChem CID 177109460) has the molecular formula C16H21NO6
and a molecular weight of 323.35 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate |
| PubChem CID | 177109460 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1COC(c2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C16H21NO6/c1-4-16(2,3)15(18)22-10-11-9-21-14(23-11)12-7-5-6-8-13(12)17(19)20/h5-8,11,14H,4,9-10H2,1-3H3 |
| InChIKey | CZSLLOIHCWLBAQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate?
The IUPAC name of [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate (CID 177109460) is [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate.
What is the SMILES notation for [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate?
The canonical SMILES for [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OCC1COC(c2ccccc2[N+](=O)[O-])O1.
What is the InChIKey of [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate?
The InChIKey is CZSLLOIHCWLBAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO6/c1-4-16(2,3)15(18)22-10-11-9-21-14(23-11)12-7-5-6-8-13(12)17(19)20/h5-8,11,14H,4,9-10H2,1-3H3.
What are the key properties of [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate?
[2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate has a molecular weight of 323.35 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-nitrophenyl)-1,3-dioxolan-4-yl]methyl 2,2-dimethylbutanoate is sourced from PubChem (CID 177109460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).