C16H12F5NO3 — CID 10713597
(2S)-2-hydroxy-N-[(1S)-2-hydroxy-1-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-phenylacetamide (PubChem CID 10713597) has the molecular formula C16H12F5NO3 and a molecular weight of 361.27 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[(1S)-2-hydroxy-1-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-phenylacetamide.
| Compound Name | (2S)-2-hydroxy-N-[(1S)-2-hydroxy-1-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 10713597 |
| Molecular Formula | C16H12F5NO3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | (2S)-2-hydroxy-N-[(1S)-2-hydroxy-1-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-phenylacetamide |
| SMILES | O=C(N[C@H](CO)c1c(F)c(F)c(F)c(F)c1F)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H12F5NO3/c17-10-9(11(18)13(20)14(21)12(10)19)8(6-23)22-16(25)15(24)7-4-2-1-3-5-7/h1-5,8,15,23-24H,6H2,(H,22,25)/t8-,15+/m1/s1 |
| InChIKey | CSXIVWMJDCCOSL-GLEZIHRCSA-N |
| XLogP | 2.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|