C9H13N5O2S — CID 107141058
2-[3-(1-cyclopropyltetrazol-5-yl)sulfanylazetidin-3-yl]acetic acid (PubChem CID 107141058) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[3-(1-cyclopropyltetrazol-5-yl)sulfanylazetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(1-cyclopropyltetrazol-5-yl)sulfanylazetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107141058 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[3-(1-cyclopropyltetrazol-5-yl)sulfanylazetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(Sc2nnnn2C2CC2)CNC1 |
| InChI | InChI=1S/C9H13N5O2S/c15-7(16)3-9(4-10-5-9)17-8-11-12-13-14(8)6-1-2-6/h6,10H,1-5H2,(H,15,16) |
| InChIKey | BXXACPDUASESFK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |