C20H26O5S — CID 10714681
[(3'S,5'R)-spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10714681) has the molecular formula C20H26O5S and a molecular weight of 378.49 g/mol. Its IUPAC name is [(3'S,5'R)-spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3'S,5'R)-spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10714681 |
| Molecular Formula | C20H26O5S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [(3'S,5'R)-spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC23CC4C[C@H](C2)C2(OCCO2)[C@@H](C4)C3)cc1 |
| InChI | InChI=1S/C20H26O5S/c1-14-2-4-18(5-3-14)26(21,22)25-13-19-10-15-8-16(11-19)20(17(9-15)12-19)23-6-7-24-20/h2-5,15-17H,6-13H2,1H3/t15?,16-,17+,19? |
| InChIKey | QQCGXWPSRYBZLX-RJSVMHHESA-N |
| XLogP | 3.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|