C18H26O5S — CID 134834196
3-[(9S)-9-methyl-1,4-dioxaspiro[4.4]nonan-9-yl]propyl 4-methylbenzenesulfonate (PubChem CID 134834196) has the molecular formula C18H26O5S and a molecular weight of 354.47 g/mol. Its IUPAC name is 3-[(9S)-9-methyl-1,4-dioxaspiro[4.4]nonan-9-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[(9S)-9-methyl-1,4-dioxaspiro[4.4]nonan-9-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134834196 |
| Molecular Formula | C18H26O5S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-[(9S)-9-methyl-1,4-dioxaspiro[4.4]nonan-9-yl]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@]2(C)CCCC23OCCO3)cc1 |
| InChI | InChI=1S/C18H26O5S/c1-15-5-7-16(8-6-15)24(19,20)23-12-4-10-17(2)9-3-11-18(17)21-13-14-22-18/h5-8H,3-4,9-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | YGYWMUUCYSOKDZ-KRWDZBQOSA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|