C14H16N2O3 — CID 107149445
3-(3,4-dihydro-1H-isochromen-4-ylamino)-1-methylpyrrolidine-2,5-dione (PubChem CID 107149445) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isochromen-4-ylamino)-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(3,4-dihydro-1H-isochromen-4-ylamino)-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 107149445 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-(3,4-dihydro-1H-isochromen-4-ylamino)-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(NC2COCc3ccccc32)C1=O |
| InChI | InChI=1S/C14H16N2O3/c1-16-13(17)6-11(14(16)18)15-12-8-19-7-9-4-2-3-5-10(9)12/h2-5,11-12,15H,6-8H2,1H3 |
| InChIKey | WKGJHZJWORFMGV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|