C21H40O4Si — CID 10715071
trans-ethyl (1S,2R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-methyl-2-prop-2-enoxycyclopentane-1-carboxylate (PubChem CID 10715071) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is trans-ethyl (1S,2R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-methyl-2-prop-2-enoxycyclopentane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-methyl-2-prop-2-enoxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10715071 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | trans-ethyl (1S,2R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-methyl-2-prop-2-enoxycyclopentane-1-carboxylate |
| SMILES | C=CCO[C@]1(C)CCC[C@@]1(CCCO[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C21H40O4Si/c1-9-16-24-20(6)13-11-14-21(20,18(22)23-10-2)15-12-17-25-26(7,8)19(3,4)5/h9H,1,10-17H2,2-8H3/t20-,21-/m1/s1 |
| InChIKey | BEDCIQRAZHQPBK-NHCUHLMSSA-N |
| XLogP | 5.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|