C18H36O4Si — CID 11791755
trans-ethyl (1S,2R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-2-methylcyclopentane-1-carboxylate (PubChem CID 11791755) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is trans-ethyl (1S,2R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-2-methylcyclopentane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-2-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11791755 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | trans-ethyl (1S,2R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-2-methylcyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(CCCO[Si](C)(C)C(C)(C)C)CCC[C@@]1(C)O |
| InChI | InChI=1S/C18H36O4Si/c1-8-21-15(19)18(12-9-11-17(18,5)20)13-10-14-22-23(6,7)16(2,3)4/h20H,8-14H2,1-7H3/t17-,18-/m1/s1 |
| InChIKey | ZAMXSXNBMZTTCQ-QZTJIDSGSA-N |
| XLogP | 4.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|