C18H38O4Si — CID 10545575
ethyl 6-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxypropan-2-yl)-2-methylhexanoate (PubChem CID 10545575) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is ethyl 6-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxypropan-2-yl)-2-methylhexanoate.
| Compound Name | ethyl 6-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxypropan-2-yl)-2-methylhexanoate |
|---|---|
| PubChem CID | 10545575 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | ethyl 6-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxypropan-2-yl)-2-methylhexanoate |
| SMILES | CCOC(=O)C(C)(CCCCO[Si](C)(C)C(C)(C)C)C(C)(C)O |
| InChI | InChI=1S/C18H38O4Si/c1-10-21-15(19)18(7,17(5,6)20)13-11-12-14-22-23(8,9)16(2,3)4/h20H,10-14H2,1-9H3 |
| InChIKey | UCHVNNYFNZGMEQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|