C24H50O6Si2 — CID 46844207
2-trimethylsilylethyl (3R,7S,9R)-7-acetyloxy-3-hydroxy-3-methyl-9-triethylsilyloxydecanoate (PubChem CID 46844207) has the molecular formula C24H50O6Si2 and a molecular weight of 490.83 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3R,7S,9R)-7-acetyloxy-3-hydroxy-3-methyl-9-triethylsilyloxydecanoate.
| Compound Name | 2-trimethylsilylethyl (3R,7S,9R)-7-acetyloxy-3-hydroxy-3-methyl-9-triethylsilyloxydecanoate |
|---|---|
| PubChem CID | 46844207 |
| Molecular Formula | C24H50O6Si2 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 2-trimethylsilylethyl (3R,7S,9R)-7-acetyloxy-3-hydroxy-3-methyl-9-triethylsilyloxydecanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](C)C[C@H](CCC[C@@](C)(O)CC(=O)OCC[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C24H50O6Si2/c1-10-32(11-2,12-3)30-20(4)18-22(29-21(5)25)14-13-15-24(6,27)19-23(26)28-16-17-31(7,8)9/h20,22,27H,10-19H2,1-9H3/t20-,22+,24-/m1/s1 |
| InChIKey | WJIDOUGBTBOKFV-JCTONOIOSA-N |
| XLogP | 5.91 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|