C30H60O6Si — CID 11307301
diethyl 2-[(3S)-3-hydroxy-3-[tri(propan-2-yl)silyloxymethyl]dodecyl]-2-methylpropanedioate (PubChem CID 11307301) has the molecular formula C30H60O6Si and a molecular weight of 544.89 g/mol. Its IUPAC name is diethyl 2-[(3S)-3-hydroxy-3-[tri(propan-2-yl)silyloxymethyl]dodecyl]-2-methylpropanedioate.
| Compound Name | diethyl 2-[(3S)-3-hydroxy-3-[tri(propan-2-yl)silyloxymethyl]dodecyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 11307301 |
| Molecular Formula | C30H60O6Si |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 544.42 |
| IUPAC Name | diethyl 2-[(3S)-3-hydroxy-3-[tri(propan-2-yl)silyloxymethyl]dodecyl]-2-methylpropanedioate |
| SMILES | CCCCCCCCC[C@](O)(CCC(C)(C(=O)OCC)C(=O)OCC)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H60O6Si/c1-11-14-15-16-17-18-19-20-30(33,23-36-37(24(4)5,25(6)7)26(8)9)22-21-29(10,27(31)34-12-2)28(32)35-13-3/h24-26,33H,11-23H2,1-10H3/t30-/m0/s1 |
| InChIKey | KEYHPYIDILZKOO-PMERELPUSA-N |
| XLogP | 7.96 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|