C17H26ClN3 — CID 107155595
2-chloro-N-[(1-ethylindazol-3-yl)methyl]-4,4-dimethylpentan-1-amine (PubChem CID 107155595) has the molecular formula C17H26ClN3 and a molecular weight of 307.87 g/mol. Its IUPAC name is 2-chloro-N-[(1-ethylindazol-3-yl)methyl]-4,4-dimethylpentan-1-amine.
| Compound Name | 2-chloro-N-[(1-ethylindazol-3-yl)methyl]-4,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 107155595 |
| Molecular Formula | C17H26ClN3 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-chloro-N-[(1-ethylindazol-3-yl)methyl]-4,4-dimethylpentan-1-amine |
| SMILES | CCn1nc(CNCC(Cl)CC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H26ClN3/c1-5-21-16-9-7-6-8-14(16)15(20-21)12-19-11-13(18)10-17(2,3)4/h6-9,13,19H,5,10-12H2,1-4H3 |
| InChIKey | RLZWXTLWQKBLGP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|