C13H21BrN2O2 — CID 107156647
N-(2-bromo-4,4-dimethylpentyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 107156647) has the molecular formula C13H21BrN2O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 107156647 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NCC(Br)CC(C)(C)C)o1 |
| InChI | InChI=1S/C13H21BrN2O2/c1-8-11(18-9(2)16-8)12(17)15-7-10(14)6-13(3,4)5/h10H,6-7H2,1-5H3,(H,15,17) |
| InChIKey | ZYKMNMBHOVHXKB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|