C10H13N3O2 — CID 79026402
N-(2-cyanopropyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 79026402) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(2-cyanopropyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(2-cyanopropyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 79026402 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-(2-cyanopropyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NCC(C)C#N)o1 |
| InChI | InChI=1S/C10H13N3O2/c1-6(4-11)5-12-10(14)9-7(2)13-8(3)15-9/h6H,5H2,1-3H3,(H,12,14) |
| InChIKey | XJOMPSSDDMWUTA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |