C16H24ClNO3 — CID 107156830
N-(2-chloro-4,4-dimethylpentyl)-3,5-dimethoxybenzamide (PubChem CID 107156830) has the molecular formula C16H24ClNO3 and a molecular weight of 313.83 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-3,5-dimethoxybenzamide.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 107156830 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(Cl)CC(C)(C)C)c1 |
| InChI | InChI=1S/C16H24ClNO3/c1-16(2,3)9-12(17)10-18-15(19)11-6-13(20-4)8-14(7-11)21-5/h6-8,12H,9-10H2,1-5H3,(H,18,19) |
| InChIKey | NZRDJZSQHUGTKQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|