C24H29NO5 — CID 10716565
1-[5-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-1,3-benzodioxol-4-yl]-2,2-dimethylpropan-1-one (PubChem CID 10716565) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[5-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-1,3-benzodioxol-4-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[5-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-1,3-benzodioxol-4-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 10716565 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-[5-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-1,3-benzodioxol-4-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc3c(c1C(=O)C(C)(C)C)OCO3)NCC2 |
| InChI | InChI=1S/C24H29NO5/c1-24(2,3)23(26)21-15(6-7-18-22(21)30-13-29-18)10-17-16-12-20(28-5)19(27-4)11-14(16)8-9-25-17/h6-7,11-12,17,25H,8-10,13H2,1-5H3 |
| InChIKey | GYSGSDZQSQYMLI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |