C20H22BF2N3O4 — CID 10716842
difluoroboranyl 7-(3-acetamidopyrrolidin-1-yl)-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate (PubChem CID 10716842) has the molecular formula C20H22BF2N3O4 and a molecular weight of 417.22 g/mol. Its IUPAC name is difluoroboranyl 7-(3-acetamidopyrrolidin-1-yl)-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate.
| Compound Name | difluoroboranyl 7-(3-acetamidopyrrolidin-1-yl)-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10716842 |
| Molecular Formula | C20H22BF2N3O4 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | difluoroboranyl 7-(3-acetamidopyrrolidin-1-yl)-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate |
| SMILES | CC(=O)NC1CCN(c2ccc3c(=O)c(C(=O)OB(F)F)cn(C4CC4)c3c2C)C1 |
| InChI | InChI=1S/C20H22BF2N3O4/c1-11-17(25-8-7-13(9-25)24-12(2)27)6-5-15-18(11)26(14-3-4-14)10-16(19(15)28)20(29)30-21(22)23/h5-6,10,13-14H,3-4,7-9H2,1-2H3,(H,24,27) |
| InChIKey | KIJBBZJYFLDPHN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|