C12H18N4O3 — CID 107172588
N-(azepan-4-yl)-N-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 107172588) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(azepan-4-yl)-N-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-(azepan-4-yl)-N-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 107172588 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-(azepan-4-yl)-N-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | CN(C(=O)c1cc(=O)[nH]c(=O)[nH]1)C1CCCNCC1 |
| InChI | InChI=1S/C12H18N4O3/c1-16(8-3-2-5-13-6-4-8)11(18)9-7-10(17)15-12(19)14-9/h7-8,13H,2-6H2,1H3,(H2,14,15,17,19) |
| InChIKey | MOKGANPTMJGILC-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |