C9H17N5 — CID 107176865
5-(2,2-dimethylcyclopentyl)-1,2,4-triazole-3,4-diamine (PubChem CID 107176865) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-(2,2-dimethylcyclopentyl)-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-(2,2-dimethylcyclopentyl)-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 107176865 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 5-(2,2-dimethylcyclopentyl)-1,2,4-triazole-3,4-diamine |
| SMILES | CC1(C)CCCC1c1nnc(N)n1N |
| InChI | InChI=1S/C9H17N5/c1-9(2)5-3-4-6(9)7-12-13-8(10)14(7)11/h6H,3-5,11H2,1-2H3,(H2,10,13) |
| InChIKey | AFAVIADGPWDBSI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |