C10H16N2O — CID 107179723
3-(2,2-dimethylcyclopentyl)-1,2-oxazol-5-amine (PubChem CID 107179723) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(2,2-dimethylcyclopentyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(2,2-dimethylcyclopentyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 107179723 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-(2,2-dimethylcyclopentyl)-1,2-oxazol-5-amine |
| SMILES | CC1(C)CCCC1c1cc(N)on1 |
| InChI | InChI=1S/C10H16N2O/c1-10(2)5-3-4-7(10)8-6-9(11)13-12-8/h6-7H,3-5,11H2,1-2H3 |
| InChIKey | PGOZVXHHMFETHK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |