C16H22N4 — CID 107179267
5-(2,2-dimethylcyclohexyl)-4-pyridin-3-yl-1H-pyrazol-3-amine (PubChem CID 107179267) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 5-(2,2-dimethylcyclohexyl)-4-pyridin-3-yl-1H-pyrazol-3-amine.
| Compound Name | 5-(2,2-dimethylcyclohexyl)-4-pyridin-3-yl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 107179267 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 5-(2,2-dimethylcyclohexyl)-4-pyridin-3-yl-1H-pyrazol-3-amine |
| SMILES | CC1(C)CCCCC1c1[nH]nc(N)c1-c1cccnc1 |
| InChI | InChI=1S/C16H22N4/c1-16(2)8-4-3-7-12(16)14-13(15(17)20-19-14)11-6-5-9-18-10-11/h5-6,9-10,12H,3-4,7-8H2,1-2H3,(H3,17,19,20) |
| InChIKey | ZZKSUFDPLVOWOZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |