C27H43N3O2 — CID 10718013
(2R,5R,12S,15R,16R)-5-azido-2,16-dimethyl-15-(6-methylheptan-2-yl)-8-oxatetracyclo[9.7.0.02,7.012,16]octadec-6-en-9-one (PubChem CID 10718013) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is (2R,5R,12S,15R,16R)-5-azido-2,16-dimethyl-15-(6-methylheptan-2-yl)-8-oxatetracyclo[9.7.0.02,7.012,16]octadec-6-en-9-one.
| Compound Name | (2R,5R,12S,15R,16R)-5-azido-2,16-dimethyl-15-(6-methylheptan-2-yl)-8-oxatetracyclo[9.7.0.02,7.012,16]octadec-6-en-9-one |
|---|---|
| PubChem CID | 10718013 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | (2R,5R,12S,15R,16R)-5-azido-2,16-dimethyl-15-(6-methylheptan-2-yl)-8-oxatetracyclo[9.7.0.02,7.012,16]octadec-6-en-9-one |
| SMILES | CC(C)CCCC(C)[C@H]1CC[C@H]2C3CC(=O)OC4=C[C@H](N=[N+]=[N-])CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C27H43N3O2/c1-17(2)7-6-8-18(3)21-9-10-22-20-16-25(31)32-24-15-19(29-30-28)11-13-27(24,5)23(20)12-14-26(21,22)4/h15,17-23H,6-14,16H2,1-5H3/t18?,19-,20?,21-,22+,23?,26-,27-/m1/s1 |
| InChIKey | UXDRYADGDWZJLB-RJLVBZABSA-N |
| XLogP | 7.82 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|