C28H47N3 — CID 23252245
(2S,5S,8S,9S,10R,13R,14S,17R)-2-azido-3,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 23252245) has the molecular formula C28H47N3 and a molecular weight of 425.71 g/mol. Its IUPAC name is (2S,5S,8S,9S,10R,13R,14S,17R)-2-azido-3,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (2S,5S,8S,9S,10R,13R,14S,17R)-2-azido-3,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 23252245 |
| Molecular Formula | C28H47N3 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 425.38 |
| IUPAC Name | (2S,5S,8S,9S,10R,13R,14S,17R)-2-azido-3,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC1=C[C@@H]2CC[C@@H]3[C@H](CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]34)[C@@]2(C)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C28H47N3/c1-18(2)8-7-9-19(3)23-12-13-24-22-11-10-21-16-20(4)26(30-31-29)17-28(21,6)25(22)14-15-27(23,24)5/h16,18-19,21-26H,7-15,17H2,1-6H3/t19-,21+,22+,23-,24+,25+,26+,27-,28+/m1/s1 |
| InChIKey | NWCACMNYGDWYQM-IAGOMVBCSA-N |
| XLogP | 8.95 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|