C18H24Cl2N4O5 — CID 10718269
[(Z)-[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 10718269) has the molecular formula C18H24Cl2N4O5 and a molecular weight of 447.32 g/mol. Its IUPAC name is [(Z)-[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | [(Z)-[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 10718269 |
| Molecular Formula | C18H24Cl2N4O5 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [(Z)-[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(N)=O)C(=O)O/N=C(\N)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H24Cl2N4O5/c1-18(2,3)28-17(27)23-13(6-7-15(22)25)16(26)29-24-14(21)9-10-4-5-11(19)12(20)8-10/h4-5,8,13H,6-7,9H2,1-3H3,(H2,21,24)(H2,22,25)(H,23,27)/t13-/m0/s1 |
| InChIKey | XOMNWQZCWGBAHC-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|