C16H22IN3O4 — CID 10671079
[(Z)-[1-amino-2-(4-iodophenyl)ethylidene]amino] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 10671079) has the molecular formula C16H22IN3O4 and a molecular weight of 447.27 g/mol. Its IUPAC name is [(Z)-[1-amino-2-(4-iodophenyl)ethylidene]amino] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [(Z)-[1-amino-2-(4-iodophenyl)ethylidene]amino] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 10671079 |
| Molecular Formula | C16H22IN3O4 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | [(Z)-[1-amino-2-(4-iodophenyl)ethylidene]amino] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)O/N=C(\N)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C16H22IN3O4/c1-10(19-15(22)23-16(2,3)4)14(21)24-20-13(18)9-11-5-7-12(17)8-6-11/h5-8,10H,9H2,1-4H3,(H2,18,20)(H,19,22)/t10-/m0/s1 |
| InChIKey | FXJOGIXEKMTARH-JTQLQIEISA-N |
| XLogP | 2.56 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|