C16H20F3N3O4 — CID 10643176
[(Z)-[1-amino-2-[4-(trifluoromethyl)phenyl]ethylidene]amino] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 10643176) has the molecular formula C16H20F3N3O4 and a molecular weight of 375.35 g/mol. Its IUPAC name is [(Z)-[1-amino-2-[4-(trifluoromethyl)phenyl]ethylidene]amino] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(Z)-[1-amino-2-[4-(trifluoromethyl)phenyl]ethylidene]amino] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 10643176 |
| Molecular Formula | C16H20F3N3O4 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [(Z)-[1-amino-2-[4-(trifluoromethyl)phenyl]ethylidene]amino] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)O/N=C(\N)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3N3O4/c1-15(2,3)25-14(24)21-9-13(23)26-22-12(20)8-10-4-6-11(7-5-10)16(17,18)19/h4-7H,8-9H2,1-3H3,(H2,20,22)(H,21,24) |
| InChIKey | WXYSAERKQZRQJA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|