C14H21Cl2N3O — CID 107184940
5-amino-2,3-dichloro-N-[1-(diethylamino)propan-2-yl]benzamide (PubChem CID 107184940) has the molecular formula C14H21Cl2N3O and a molecular weight of 318.25 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-[1-(diethylamino)propan-2-yl]benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-[1-(diethylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 107184940 |
| Molecular Formula | C14H21Cl2N3O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 5-amino-2,3-dichloro-N-[1-(diethylamino)propan-2-yl]benzamide |
| SMILES | CCN(CC)CC(C)NC(=O)c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H21Cl2N3O/c1-4-19(5-2)8-9(3)18-14(20)11-6-10(17)7-12(15)13(11)16/h6-7,9H,4-5,8,17H2,1-3H3,(H,18,20) |
| InChIKey | QBGPRXKHARZJMU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|