C18H35BrO9 — CID 10719329
2-[[21-(bromomethyl)-1,4,7,10,13,16,19-heptaoxacyclodocos-21-yl]oxy]ethanol (PubChem CID 10719329) has the molecular formula C18H35BrO9 and a molecular weight of 475.37 g/mol. Its IUPAC name is 2-[[21-(bromomethyl)-1,4,7,10,13,16,19-heptaoxacyclodocos-21-yl]oxy]ethanol.
| Compound Name | 2-[[21-(bromomethyl)-1,4,7,10,13,16,19-heptaoxacyclodocos-21-yl]oxy]ethanol |
|---|---|
| PubChem CID | 10719329 |
| Molecular Formula | C18H35BrO9 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[[21-(bromomethyl)-1,4,7,10,13,16,19-heptaoxacyclodocos-21-yl]oxy]ethanol |
| SMILES | OCCOC1(CBr)COCCOCCOCCOCCOCCOCCOC1 |
| InChI | InChI=1S/C18H35BrO9/c19-15-18(28-2-1-20)16-26-13-11-24-9-7-22-5-3-21-4-6-23-8-10-25-12-14-27-17-18/h20H,1-17H2 |
| InChIKey | XYGKWZHOMPIXIQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|