C28H28N2O5S — CID 10720297
(4-methoxyphenyl)methyl (5R,6S,8R,9R)-5-cyclopropyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylate (PubChem CID 10720297) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (5R,6S,8R,9R)-5-cyclopropyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (5R,6S,8R,9R)-5-cyclopropyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10720297 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (4-methoxyphenyl)methyl (5R,6S,8R,9R)-5-cyclopropyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C3C[C@H](C4CC4)[C@@H]3S[C@@H]3[C@H](NC(=O)Cc4ccccc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C28H28N2O5S/c1-34-19-11-7-17(8-12-19)15-35-28(33)24-21-14-20(18-9-10-18)25(21)36-27-23(26(32)30(24)27)29-22(31)13-16-5-3-2-4-6-16/h2-8,11-12,18,20,23,25,27H,9-10,13-15H2,1H3,(H,29,31)/t20-,23-,25+,27-/m1/s1 |
| InChIKey | CFWIALRRAIAURL-KLZKGZPJSA-N |
| XLogP | 3.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |