C29H30N2O5S — CID 10720712
(4-methoxyphenyl)methyl (2S,7R,8S,10R,11R)-12-oxo-11-[(2-phenylacetyl)amino]-9-thia-13-azatetracyclo[6.6.0.02,7.010,13]tetradec-1(14)-ene-14-carboxylate (PubChem CID 10720712) has the molecular formula C29H30N2O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,7R,8S,10R,11R)-12-oxo-11-[(2-phenylacetyl)amino]-9-thia-13-azatetracyclo[6.6.0.02,7.010,13]tetradec-1(14)-ene-14-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,7R,8S,10R,11R)-12-oxo-11-[(2-phenylacetyl)amino]-9-thia-13-azatetracyclo[6.6.0.02,7.010,13]tetradec-1(14)-ene-14-carboxylate |
|---|---|
| PubChem CID | 10720712 |
| Molecular Formula | C29H30N2O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,7R,8S,10R,11R)-12-oxo-11-[(2-phenylacetyl)amino]-9-thia-13-azatetracyclo[6.6.0.02,7.010,13]tetradec-1(14)-ene-14-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C3[C@H]4CCCC[C@H]4[C@@H]3S[C@@H]3[C@H](NC(=O)Cc4ccccc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C29H30N2O5S/c1-35-19-13-11-18(12-14-19)16-36-29(34)25-23-20-9-5-6-10-21(20)26(23)37-28-24(27(33)31(25)28)30-22(32)15-17-7-3-2-4-8-17/h2-4,7-8,11-14,20-21,24,26,28H,5-6,9-10,15-16H2,1H3,(H,30,32)/t20-,21+,24+,26-,28+/m0/s1 |
| InChIKey | NPNSJQHPQMOWOR-BBUVEYNKSA-N |
| XLogP | 3.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |