C30H32N2O5S — CID 10816109
(4-methoxyphenyl)methyl (6S,8R,9R)-10-oxo-9-[(2-phenylacetyl)amino]spiro[7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-5,1'-cyclohexane]-2-carboxylate (PubChem CID 10816109) has the molecular formula C30H32N2O5S and a molecular weight of 532.66 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6S,8R,9R)-10-oxo-9-[(2-phenylacetyl)amino]spiro[7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-5,1'-cyclohexane]-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6S,8R,9R)-10-oxo-9-[(2-phenylacetyl)amino]spiro[7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-5,1'-cyclohexane]-2-carboxylate |
|---|---|
| PubChem CID | 10816109 |
| Molecular Formula | C30H32N2O5S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (4-methoxyphenyl)methyl (6S,8R,9R)-10-oxo-9-[(2-phenylacetyl)amino]spiro[7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-5,1'-cyclohexane]-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C3CC4(CCCCC4)[C@@H]3S[C@@H]3[C@H](NC(=O)Cc4ccccc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C30H32N2O5S/c1-36-21-12-10-20(11-13-21)18-37-29(35)25-22-17-30(14-6-3-7-15-30)26(22)38-28-24(27(34)32(25)28)31-23(33)16-19-8-4-2-5-9-19/h2,4-5,8-13,24,26,28H,3,6-7,14-18H2,1H3,(H,31,33)/t24-,26-,28-/m1/s1 |
| InChIKey | WIZVLBBBBYNXME-OROMBRFGSA-N |
| XLogP | 4.36 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |