C31H34N2O5S — CID 10816403
(4-methoxyphenyl)methyl (5R,6S,8R,9R)-5-cyclohexyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylate (PubChem CID 10816403) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (5R,6S,8R,9R)-5-cyclohexyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (5R,6S,8R,9R)-5-cyclohexyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10816403 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (4-methoxyphenyl)methyl (5R,6S,8R,9R)-5-cyclohexyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C3C[C@H](C4CCCCC4)[C@@H]3S[C@@H]3[C@H](NC(=O)Cc4ccccc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C31H34N2O5S/c1-37-22-14-12-20(13-15-22)18-38-31(36)27-24-17-23(21-10-6-3-7-11-21)28(24)39-30-26(29(35)33(27)30)32-25(34)16-19-8-4-2-5-9-19/h2,4-5,8-9,12-15,21,23,26,28,30H,3,6-7,10-11,16-18H2,1H3,(H,32,34)/t23-,26-,28+,30-/m1/s1 |
| InChIKey | QWECKISWPREGFB-VEPYLSOSSA-N |
| XLogP | 4.60 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |