C14H23N3O3 — CID 107204332
5-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl-methylamino]pentan-1-ol (PubChem CID 107204332) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl-methylamino]pentan-1-ol.
| Compound Name | 5-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl-methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107204332 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 5-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl-methylamino]pentan-1-ol |
| SMILES | Cc1cnc(CN(C)CCCCCO)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H23N3O3/c1-11-9-15-13(12(2)14(11)17(19)20)10-16(3)7-5-4-6-8-18/h9,18H,4-8,10H2,1-3H3 |
| InChIKey | PTUHBLTZWVBDCH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|